Galiellalactone
| Name | Value |
|---|---|
| Weight | 194.230 g/mol |
| Zinc ID | ZINC256458627 |
| Smiles | C[C@@H]1C=C2C(=O)O[C@@H]3CC[C@@H](C1)[C@]23O |
| Molecular formula | C11H14O3 |
| Mode of inhibition | Direct STAT DBD; targetting DBD |
| CAS | 133613-71-5 |
Clinical Trials
| Study title | Status | Conditions | Link |
|---|
References
| Publication | DOI | Pubmed | PMCID |
|---|---|---|---|
| Galiellalactone is a direct inhibitor of the transcription factor STAT3 in prostate cancer cells. The Journal of biological chemistry Nicholas Don-Doncow, Zilma Escobar, Martin Johansson, Sven Kjellström, Victor Garcia, Eduardo Munoz, Olov Sterner, Anders Bjartell, Rebecka Hellsten, 289, 23, 2014-06-06, 2014-04-22, 10.1074/jbc.M114.564252 | 10.1074/jbc.M114.564252 | 24755219 | PMC4047371 |
Vendors
| Company | Lnk to product |
|---|---|
| Tocris | https://www.tocris.com/products/galiellalactone_6218 |
| Santa Cruz Biotechnology | https://www.scbt.com/p/galiellalactone-133613-71-5 |
| Caymanchemical | https://www.caymanchem.com/product/15387/galiellalactone |
| Molbase | http://www.molbase.com/en/cas-133613-71-5.html |
| Abmole | http://www.abmole.com/products/galiellalactone.html |
| Glixx Laboratories | http://glixxlabs.com/chemical-products/bioactive-screen-leads-p6/GLXC-11505 |
| Chemexpress | https://www.chemexpress.cn/133613-71-5.htm |
| BioVision | https://www.biovision.com/galiellactone.html |
Filter data
| Compound | Galiellalactone | Experiment types | EMSA, Luciferse activity, WST-1, Western Blot | Concentrations | 10.00, 100.00, 25.00, 5.00, 50.00, N/A | Cell lines | DU145, LNCaP | Organisms | Homo sapiens | Animal models | STAT proteins | STAT3, p-STAT3, p-STAT3(Y705), p-STAT3(Y727) | Other |
