Kaempferol-3-O-rutinoside
| Name | Value |
|---|---|
| Weight | 594.522 g/mol |
| Zinc ID | ZINC28816553 |
| Smiles | C[C@H]1O[C@H](OC[C@H]2O[C@@H](Oc3c(-c4ccc(O)cc4)oc4cc(O)cc(O)c4c3=O)[C@H](O)[C@@H](O)[C@@H]2O)[C@@H](O)[C@@H](O)[C@@H]1O |
| Molecular formula | C27H30O15 |
| Mode of inhibition | N/A |
| CAS | 17650-84-9 |
Clinical Trials
| Study title | Status | Conditions | Link |
|---|
References
| Publication | DOI | Pubmed | PMCID |
|---|---|---|---|
| [Synthesis of analogs of 4-methyl-5(p-fluorophenoxy)-primaquine as a tissue schizonticide of the malaria parasite]. Yao xue xue bao = Acta pharmaceutica Sinica C Chen, H Z Guo, Z H Feng, X Y Zheng, 21, 9, None, None, 10.1371/journal.pone.0055839 | 10.1371/journal.pone.0055839 | 3577792 | PMC3577792 |
Vendors
| Company | Lnk to product |
|---|---|
| Selleckchem | https://www.selleckchem.com/products/kaempferol-3-o-rutinoside.html |
Filter data
| Compound | Kaempferol-3-O-rutinoside | Experiment types | Concentrations | Cell lines | Organisms | Animal models | STAT proteins | Other |
Experiments
| Compound | Experiment type | Investigated event | Concentration | Cell line | Organism | Animal model | Stat protein | Details |
|---|