Cucurbitacin B

Name Value
Weight 558.712 g/mol
Zinc ID ZINC4097797
Smiles CC(=O)OC(C)(C)/C=C/C(=O)[C@](C)(O)[C@H]1[C@H](O)C[C@@]2(C)[C@@H]3CC=C4[C@@H](C[C@H](O)C(=O)C4(C)C)[C@]3(C)C(=O)C[C@]12C
Molecular formula C32H46O8
Mode of inhibition JAK2, STAT3; Natural product
CAS 6199-67-3

Clinical Trials

Study title Status Conditions Link
Sinuclean Nebules 45 for Treatment of Pediatric Exudative Otitis Media Completed Otitis Media With Effusion NCT02858388

References

Publication DOI Pubmed PMCID
Treatment with cucurbitacin B alone and in combination with gefitinib induces cell cycle inhibition and apoptosis via EGFR and JAK/STAT pathway in human colorectal cancer cell lines. Human & experimental toxicology A S Yar Saglam, E Alp, Z Elmazoglu, S Menevse, 35, 5, None, 2015-07-16, 10.1177/0960327115595686 10.1177/0960327115595686 26183715 26183715

Vendors

Company Lnk to product
AK Scientific Inc. https://aksci.com/item_detail.php?cat=X1115
MedChemExpress https://www.medchemexpress.com/Cucurbitacin-B.html
TargetMol https://www.targetmol.com/compound/Cucurbitacin-B
MERCK (Sigma Aldrich) https://www.sigmaaldrich.com/catalog/product/sigma/c8499?lang=pl&region=PL
Caymanchemical https://www.caymanchem.com/product/14820
Mcule https://mcule.com/MCULE-7414589561/
Selleckchem https://www.selleckchem.com/products/cucurbitacin-b.html

Filter data

Compound Cucurbitacin B
Experiment types AO/EB staining fluorescen microscopy, BrdU incorporation-ELISA, ELISA, LDH release assay, Luciferase activity, MTT, RT-qPCR, TUNEL assay, Western Blot
Concentrations 0.01, 0.03, 0.05, 0.50, 1.00, 10.00, 20.00, 40.00, 60.00, 80.00
Cell lines HCT-116, HT-29, Microglia
Organisms Homo sapiens
Animal models
STAT proteins STAT1, STAT3, p-STAT1, p-STAT3
Other ARE/HO-1, Bad, Bak, Bax, Bcl-2, Bcl-xL, Bim, COX-2, Cleaved Caspase-3, Cyclin D1, EGFR, ERK, HO-1, HQO1, JAK1, JNK, Nf-κB, Nrf2, TBP, iNOS, p-ERK, p-IκBα, p-JAK1, p-JNK, p-p38, p-p65, p27kip1, p38, p65, pEGFR, tubulin, α-tubulin, β-actin

Experiments

Compound Experiment type Investigated event Concentration Cell line Organism Animal model Stat protein Details
Cucurbitacin B ELISA Influence on pro-inflammatory molecules 0.50 µM Microglia Homo sapiens
Cucurbitacin B Western Blot Influence on proteins levels 0.50 µM Microglia Homo sapiens
Cucurbitacin B Western Blot Influence on proteins levels 0.50 µM Microglia Homo sapiens
Cucurbitacin B Western Blot Influence on proteins levels 0.50 µM Microglia Homo sapiens
Cucurbitacin B Western Blot Influence on proteins levels 0.50 µM Microglia Homo sapiens
Cucurbitacin B Western Blot Influence on proteins levels 0.50 µM Microglia Homo sapiens
Cucurbitacin B Western Blot Influence on proteins levels 0.50 µM Microglia Homo sapiens
Cucurbitacin B Western Blot Influence on proteins levels 0.50 µM Microglia Homo sapiens
Cucurbitacin B Luciferase activity Influence on proteins levels 0.50 µM Microglia Homo sapiens
Cucurbitacin B Western Blot Influence on protein activity 0.50 µM Microglia Homo sapiens
Cucurbitacin B Western Blot Influence on protein activity 0.50 µM Microglia Homo sapiens
Cucurbitacin B Western Blot Influence on protein activity 0.50 µM Microglia Homo sapiens
Cucurbitacin B Western Blot Influence on protein activity 0.50 µM Microglia Homo sapiens
Cucurbitacin B Western Blot Influence on protein activity 0.50 µM Microglia Homo sapiens
Cucurbitacin B Western Blot Influence on protein activity 0.50 µM Microglia Homo sapiens
Cucurbitacin B Western Blot Influence on protein activity 0.50 µM Microglia Homo sapiens
Cucurbitacin B Western Blot Influence on protein activity 0.50 µM Microglia Homo sapiens
Cucurbitacin B Western Blot Influence on protein activity 0.50 µM Microglia Homo sapiens p-STAT1
Cucurbitacin B Western Blot Influence on protein activity 0.50 µM Microglia Homo sapiens STAT1
Cucurbitacin B Western Blot Influence on protein activity 0.50 µM Microglia Homo sapiens p-STAT3
Cucurbitacin B Western Blot Influence on protein activity 0.50 µM Microglia Homo sapiens STAT3
Cucurbitacin B Western Blot Influence on protein activity 0.50 µM Microglia Homo sapiens
Cucurbitacin B Western Blot Influence on protein activity 0.50 µM Microglia Homo sapiens
Cucurbitacin B Luciferase activity Influence on protein activity 0.50 µM Microglia Homo sapiens
Cucurbitacin B Western Blot Influence on protein activity 0.50 µM Microglia Homo sapiens
Cucurbitacin B Western Blot Influence on protein activity 0.50 µM Microglia Homo sapiens
Cucurbitacin B Western Blot Influence on protein activity 0.50 µM Microglia Homo sapiens
Cucurbitacin B Luciferase activity Influence on protein activity 0.50 µM Microglia Homo sapiens
Cucurbitacin B Luciferase activity Influence on protein activity in transfected cells 0.50 µM Microglia Homo sapiens
Cucurbitacin B MTT Influence on cell viability 0.50 µM Microglia Homo sapiens
Cucurbitacin B TUNEL assay Influence on cell viability 0.50 µM Microglia Homo sapiens
Cucurbitacin B Western Blot Influence on cell viability 0.50 µM Microglia Homo sapiens
Cucurbitacin B Western Blot Influence on cell viability 0.50 µM Microglia Homo sapiens
Cucurbitacin B MTT Influence on cell viability 0.01 µM HT-29 Homo sapiens
Cucurbitacin B MTT Influence on cell viability 0.03 µM HT-29 Homo sapiens
Cucurbitacin B MTT Influence on cell viability 0.05 µM HT-29 Homo sapiens
Cucurbitacin B MTT Influence on cell viability 0.50 µM HT-29 Homo sapiens
Cucurbitacin B MTT Influence on cell viability 1.00 µM HT-29 Homo sapiens
Cucurbitacin B MTT Influence on cell viability 10.00 µM HT-29 Homo sapiens
Cucurbitacin B MTT Influence on cell viability 20.00 µM HT-29 Homo sapiens
Cucurbitacin B MTT Influence on cell viability 40.00 µM HT-29 Homo sapiens
Cucurbitacin B MTT Influence on cell viability 60.00 µM HT-29 Homo sapiens
Cucurbitacin B MTT Influence on cell viability 80.00 µM HT-29 Homo sapiens
Cucurbitacin B MTT Influence on cell viability 0.01 µM HCT-116 Homo sapiens
Cucurbitacin B MTT Influence on cell viability 0.03 µM HCT-116 Homo sapiens
Cucurbitacin B MTT Influence on cell viability 0.05 µM HCT-116 Homo sapiens
Cucurbitacin B MTT Influence on cell viability 0.50 µM HCT-116 Homo sapiens
Cucurbitacin B MTT Influence on cell viability 1.00 µM HCT-116 Homo sapiens
Cucurbitacin B MTT Influence on cell viability 10.00 µM HCT-116 Homo sapiens
Cucurbitacin B MTT Influence on cell viability 20.00 µM HCT-116 Homo sapiens
Cucurbitacin B MTT Influence on cell viability 40.00 µM HCT-116 Homo sapiens
Cucurbitacin B MTT Influence on cell viability 60.00 µM HCT-116 Homo sapiens
Cucurbitacin B MTT Influence on cell viability 80.00 µM HCT-116 Homo sapiens
Cucurbitacin B AO/EB staining fluorescen microscopy Influence on cell viability 0.01 µM HT-29 Homo sapiens
Cucurbitacin B AO/EB staining fluorescen microscopy Influence on cell viability 0.05 µM HT-29 Homo sapiens
Cucurbitacin B AO/EB staining fluorescen microscopy Influence on cell viability 0.50 µM HT-29 Homo sapiens
Cucurbitacin B AO/EB staining fluorescen microscopy Influence on cell viability 1.00 µM HT-29 Homo sapiens
Cucurbitacin B AO/EB staining fluorescen microscopy Influence on cell viability 10.00 µM HT-29 Homo sapiens
Cucurbitacin B AO/EB staining fluorescen microscopy Influence on cell viability 40.00 µM HT-29 Homo sapiens
Cucurbitacin B AO/EB staining fluorescen microscopy Influence on cell viability 0.01 µM HCT-116 Homo sapiens
Cucurbitacin B AO/EB staining fluorescen microscopy Influence on cell viability 0.05 µM HCT-116 Homo sapiens
Cucurbitacin B AO/EB staining fluorescen microscopy Influence on cell viability 0.50 µM HCT-116 Homo sapiens
Cucurbitacin B AO/EB staining fluorescen microscopy Influence on cell viability 1.00 µM HCT-116 Homo sapiens
Cucurbitacin B AO/EB staining fluorescen microscopy Influence on cell viability 10.00 µM HCT-116 Homo sapiens
Cucurbitacin B AO/EB staining fluorescen microscopy Influence on cell viability 40.00 µM HCT-116 Homo sapiens
Cucurbitacin B AO/EB staining fluorescen microscopy Influence on cell apoptosis 0.01 µM HT-29 Homo sapiens
Cucurbitacin B AO/EB staining fluorescen microscopy Influence on cell apoptosis 0.05 µM HT-29 Homo sapiens
Cucurbitacin B AO/EB staining fluorescen microscopy Influence on cell apoptosis 0.50 µM HT-29 Homo sapiens
Cucurbitacin B AO/EB staining fluorescen microscopy Influence on cell apoptosis 1.00 µM HT-29 Homo sapiens
Cucurbitacin B AO/EB staining fluorescen microscopy Influence on cell apoptosis 10.00 µM HT-29 Homo sapiens
Cucurbitacin B AO/EB staining fluorescen microscopy Influence on cell apoptosis 40.00 µM HT-29 Homo sapiens
Cucurbitacin B AO/EB staining fluorescen microscopy Influence on cell apoptosis 0.01 µM HCT-116 Homo sapiens
Cucurbitacin B AO/EB staining fluorescen microscopy Influence on cell apoptosis 0.05 µM HCT-116 Homo sapiens
Cucurbitacin B AO/EB staining fluorescen microscopy Influence on cell apoptosis 0.50 µM HCT-116 Homo sapiens
Cucurbitacin B AO/EB staining fluorescen microscopy Influence on cell apoptosis 1.00 µM HCT-116 Homo sapiens
Cucurbitacin B AO/EB staining fluorescen microscopy Influence on cell apoptosis 10.00 µM HCT-116 Homo sapiens
Cucurbitacin B AO/EB staining fluorescen microscopy Influence on cell apoptosis 40.00 µM HCT-116 Homo sapiens
Cucurbitacin B AO/EB staining fluorescen microscopy Influence on cell necrosis 0.01 µM HT-29 Homo sapiens
Cucurbitacin B AO/EB staining fluorescen microscopy Influence on cell necrosis 0.05 µM HT-29 Homo sapiens
Cucurbitacin B AO/EB staining fluorescen microscopy Influence on cell necrosis 0.50 µM HT-29 Homo sapiens
Cucurbitacin B AO/EB staining fluorescen microscopy Influence on cell necrosis 1.00 µM HT-29 Homo sapiens
Cucurbitacin B AO/EB staining fluorescen microscopy Influence on cell necrosis 10.00 µM HT-29 Homo sapiens
Cucurbitacin B AO/EB staining fluorescen microscopy Influence on cell necrosis 40.00 µM HT-29 Homo sapiens
Cucurbitacin B AO/EB staining fluorescen microscopy Influence on cell necrosis 0.01 µM HCT-116 Homo sapiens
Cucurbitacin B AO/EB staining fluorescen microscopy Influence on cell necrosis 0.05 µM HCT-116 Homo sapiens
Cucurbitacin B AO/EB staining fluorescen microscopy Influence on cell necrosis 0.50 µM HCT-116 Homo sapiens
Cucurbitacin B AO/EB staining fluorescen microscopy Influence on cell necrosis 1.00 µM HCT-116 Homo sapiens
Cucurbitacin B AO/EB staining fluorescen microscopy Influence on cell necrosis 10.00 µM HCT-116 Homo sapiens
Cucurbitacin B AO/EB staining fluorescen microscopy Influence on cell necrosis 40.00 µM HCT-116 Homo sapiens
Cucurbitacin B LDH release assay Cytotoxicity effect 0.01 µM HT-29 Homo sapiens
Cucurbitacin B LDH release assay Cytotoxicity effect 0.05 µM HT-29 Homo sapiens
Cucurbitacin B LDH release assay Cytotoxicity effect 0.50 µM HT-29 Homo sapiens
Cucurbitacin B LDH release assay Cytotoxicity effect 0.01 µM HCT-116 Homo sapiens
Cucurbitacin B LDH release assay Cytotoxicity effect 0.05 µM HCT-116 Homo sapiens
Cucurbitacin B LDH release assay Cytotoxicity effect 0.50 µM HCT-116 Homo sapiens
Cucurbitacin B BrdU incorporation-ELISA Influence on DNA synthesis 0.01 µM HT-29 Homo sapiens
Cucurbitacin B BrdU incorporation-ELISA Influence on DNA synthesis 0.05 µM HT-29 Homo sapiens
Cucurbitacin B BrdU incorporation-ELISA Influence on DNA synthesis 0.50 µM HT-29 Homo sapiens
Cucurbitacin B BrdU incorporation-ELISA Influence on DNA synthesis 0.01 µM HCT-116 Homo sapiens
Cucurbitacin B BrdU incorporation-ELISA Influence on DNA synthesis 0.05 µM HCT-116 Homo sapiens
Cucurbitacin B BrdU incorporation-ELISA Influence on DNA synthesis 0.50 µM HCT-116 Homo sapiens
Cucurbitacin B ELISA Influence on DNA fragmentation 1.00 µM HT-29 Homo sapiens
Cucurbitacin B ELISA Influence on DNA fragmentation 10.00 µM HT-29 Homo sapiens
Cucurbitacin B ELISA Influence on DNA fragmentation 40.00 µM HT-29 Homo sapiens
Cucurbitacin B ELISA Influence on DNA fragmentation 1.00 µM HCT-116 Homo sapiens
Cucurbitacin B ELISA Influence on DNA fragmentation 10.00 µM HCT-116 Homo sapiens
Cucurbitacin B ELISA Influence on DNA fragmentation 40.00 µM HCT-116 Homo sapiens
Cucurbitacin B ELISA Influence on protein level 0.01 µM HT-29 Homo sapiens
Cucurbitacin B ELISA Influence on protein level 0.05 µM HT-29 Homo sapiens
Cucurbitacin B ELISA Influence on protein level 0.50 µM HT-29 Homo sapiens
Cucurbitacin B ELISA Influence on protein level 0.01 µM HCT-116 Homo sapiens
Cucurbitacin B ELISA Influence on protein level 0.05 µM HCT-116 Homo sapiens
Cucurbitacin B RT-qPCR Influence on gene expresion 0.50 µM HT-29 Homo sapiens
Cucurbitacin B RT-qPCR Influence on gene expresion 0.50 µM HT-29 Homo sapiens
Cucurbitacin B RT-qPCR Influence on gene expresion 0.50 µM HT-29 Homo sapiens
Cucurbitacin B RT-qPCR Influence on gene expresion 0.50 µM HT-29 Homo sapiens
Cucurbitacin B RT-qPCR Influence on gene expresion 0.50 µM HT-29 Homo sapiens
Cucurbitacin B RT-qPCR Influence on gene expresion 0.50 µM HT-29 Homo sapiens
Cucurbitacin B RT-qPCR Influence on gene expresion 0.50 µM HCT-116 Homo sapiens
Cucurbitacin B RT-qPCR Influence on gene expresion 0.50 µM HCT-116 Homo sapiens
Cucurbitacin B RT-qPCR Influence on gene expresion 0.50 µM HCT-116 Homo sapiens
Cucurbitacin B RT-qPCR Influence on gene expresion 0.50 µM HCT-116 Homo sapiens
Cucurbitacin B RT-qPCR Influence on gene expresion 0.50 µM HCT-116 Homo sapiens
Cucurbitacin B RT-qPCR Influence on gene expresion 0.50 µM HCT-116 Homo sapiens
Cucurbitacin B Western Blot Influence on protein levels 0.50 µM HT-29 Homo sapiens
Cucurbitacin B Western Blot Influence on protein levels 0.50 µM HT-29 Homo sapiens
Cucurbitacin B Western Blot Influence on protein levels 0.50 µM HT-29 Homo sapiens
Cucurbitacin B Western Blot Influence on protein levels 0.50 µM HT-29 Homo sapiens
Cucurbitacin B Western Blot Influence on protein levels 0.50 µM HT-29 Homo sapiens
Cucurbitacin B Western Blot Influence on protein levels 0.50 µM HT-29 Homo sapiens
Cucurbitacin B Western Blot Influence on protein levels 0.50 µM HCT-116 Homo sapiens
Cucurbitacin B Western Blot Influence on protein levels 0.50 µM HCT-116 Homo sapiens
Cucurbitacin B Western Blot Influence on protein levels 0.50 µM HCT-116 Homo sapiens
Cucurbitacin B Western Blot Influence on protein levels 0.50 µM HCT-116 Homo sapiens
Cucurbitacin B Western Blot Influence on protein levels 0.50 µM HCT-116 Homo sapiens
Cucurbitacin B Western Blot Influence on protein levels 0.50 µM HCT-116 Homo sapiens
Cucurbitacin B Western Blot Influence on protein levels 0.50 µM HT-29 Homo sapiens
Cucurbitacin B Western Blot Influence on protein levels 0.50 µM HT-29 Homo sapiens
Cucurbitacin B Western Blot Influence on protein levels 0.50 µM HT-29 Homo sapiens STAT3
Cucurbitacin B Western Blot Influence on protein levels 0.50 µM HT-29 Homo sapiens p-STAT3
Cucurbitacin B Western Blot Influence on protein levels 0.50 µM HCT-116 Homo sapiens
Cucurbitacin B Western Blot Influence on protein levels 0.50 µM HCT-116 Homo sapiens
Cucurbitacin B Western Blot Influence on protein levels 0.50 µM HCT-116 Homo sapiens STAT3
Cucurbitacin B Western Blot Influence on protein levels 0.50 µM HCT-116 Homo sapiens p-STAT3